About 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one
6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one (PubChem CID 137006665) has the molecular formula C35H25BrN4O
and a molecular weight of 597.52 g/mol. Its IUPAC name is 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one.
Molecular Properties
| Compound Name | 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one |
| PubChem CID | 137006665 |
| Molecular Formula | C35H25BrN4O |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one |
| SMILES | Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3cc4[nH]c(=O)c(Br)cc4cc23)ccn1 |
| InChI | InChI=1S/C35H25BrN4O/c1-23-19-24(17-18-37-23)33-29-20-25-21-30(36)34(41)38-31(25)22-32(29)40(39-33)35(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-22H,1H3,(H,38,41) |
| InChIKey | KSOZYAZTYKEURF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The IUPAC name of 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one (CID 137006665) is 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one.
What is the SMILES notation for 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The canonical SMILES for 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one is Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3cc4[nH]c(=O)c(Br)cc4cc23)ccn1.
What is the InChIKey of 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
The InChIKey is KSOZYAZTYKEURF-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H25BrN4O/c1-23-19-24(17-18-37-23)33-29-20-25-21-30(36)34(41)38-31(25)22-32(29)40(39-33)35(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-22H,1H3,(H,38,41).
What are the key properties of 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one?
6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one has a molecular weight of 597.52 g/mol, XLogP of 7.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(2-methyl-4-pyridinyl)-1-trityl-8H-pyrazolo[4,5-g]quinolin-7-one is sourced from PubChem (CID 137006665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).