C31H48Cl2N6O — CID 137006890
N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-[[3-(2,2-dimethylpropyl)-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]amino]ethyl]propanamide (PubChem CID 137006890) has the molecular formula C31H48Cl2N6O and a molecular weight of 591.67 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-[[3-(2,2-dimethylpropyl)-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]amino]ethyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-[[3-(2,2-dimethylpropyl)-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 137006890 |
| Molecular Formula | C31H48Cl2N6O |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-[[3-(2,2-dimethylpropyl)-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]amino]ethyl]propanamide |
| SMILES | CC1CNc2c(CC(C)(C)C)c(NCCN(C(=O)CCNCCc3ccc(Cl)c(Cl)c3)C3CCCCC3)nn2C1 |
| InChI | InChI=1S/C31H48Cl2N6O/c1-22-20-36-30-25(19-31(2,3)4)29(37-39(30)21-22)35-16-17-38(24-8-6-5-7-9-24)28(40)13-15-34-14-12-23-10-11-26(32)27(33)18-23/h10-11,18,22,24,34,36H,5-9,12-17,19-21H2,1-4H3,(H,35,37) |
| InChIKey | JSZJQQUENMOHRB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|