About N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride
N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride (PubChem CID 137007043) has the molecular formula C12H12ClN3
and a molecular weight of 233.70 g/mol. Its IUPAC name is N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride |
| PubChem CID | 137007043 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride |
| SMILES | CN=C1Nc2cccc3cccc(c23)N1.Cl |
| InChI | InChI=1S/C12H11N3.ClH/c1-13-12-14-9-6-2-4-8-5-3-7-10(15-12)11(8)9;/h2-7H,1H3,(H2,13,14,15);1H |
| InChIKey | VSGJDDABEPCUDB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride?
The IUPAC name of N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride (CID 137007043) is N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride.
What is the SMILES notation for N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride?
The canonical SMILES for N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride is CN=C1Nc2cccc3cccc(c23)N1.Cl.
What is the InChIKey of N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride?
The InChIKey is VSGJDDABEPCUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3.ClH/c1-13-12-14-9-6-2-4-8-5-3-7-10(15-12)11(8)9;/h2-7H,1H3,(H2,13,14,15);1H.
What are the key properties of N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride?
N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride has a molecular weight of 233.70 g/mol, XLogP of 3.08, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,3-dihydroperimidin-2-imine;hydrochloride is sourced from PubChem (CID 137007043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).