C19H19BrN4O5 — CID 137007116
4-[(2-acetamidoacetyl)amino]-N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide (PubChem CID 137007116) has the molecular formula C19H19BrN4O5 and a molecular weight of 463.29 g/mol. Its IUPAC name is 4-[(2-acetamidoacetyl)amino]-N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2-acetamidoacetyl)amino]-N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137007116 |
| Molecular Formula | C19H19BrN4O5 |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 4-[(2-acetamidoacetyl)amino]-N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(NC(=O)CNC(C)=O)cc2)cc(Br)c1O |
| InChI | InChI=1S/C19H19BrN4O5/c1-11(25)21-10-17(26)23-14-5-3-13(4-6-14)19(28)24-22-9-12-7-15(20)18(27)16(8-12)29-2/h3-9,27H,10H2,1-2H3,(H,21,25)(H,23,26)(H,24,28)/b22-9+ |
| InChIKey | MMHIJTPHVTUWQY-LSFURLLWSA-N |
| XLogP | 2.00 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|