C10H14IN3O3 — CID 137007664
methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoate (PubChem CID 137007664) has the molecular formula C10H14IN3O3 and a molecular weight of 351.14 g/mol. Its IUPAC name is methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 137007664 |
| Molecular Formula | C10H14IN3O3 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H14IN3O3/c1-6(10(16)17-3)4-14(2)8-7(11)9(15)13-5-12-8/h5-6H,4H2,1-3H3,(H,12,13,15) |
| InChIKey | NFTBICFOSSHHOM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|