C11H15N3O3 — CID 137007680
methyl 4-methyl-1-(6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate (PubChem CID 137007680) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl 4-methyl-1-(6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 4-methyl-1-(6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 137007680 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | methyl 4-methyl-1-(6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(c2cc(=O)[nH]cn2)CC1C |
| InChI | InChI=1S/C11H15N3O3/c1-7-4-14(5-8(7)11(16)17-2)9-3-10(15)13-6-12-9/h3,6-8H,4-5H2,1-2H3,(H,12,13,15) |
| InChIKey | BFGRCGSGNBAGQQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |