C10H14N4O3 — CID 137007686
methyl 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate (PubChem CID 137007686) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is methyl 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 137007686 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | methyl 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(c2nc[nH]c(=O)c2N)C1 |
| InChI | InChI=1S/C10H14N4O3/c1-17-10(16)6-2-3-14(4-6)8-7(11)9(15)13-5-12-8/h5-6H,2-4,11H2,1H3,(H,12,13,15) |
| InChIKey | GFJIHGYORUFGCS-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |