C13H20N4O — CID 137007881
4-[2-[(cyclopropylamino)methyl]pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 137007881) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[2-[(cyclopropylamino)methyl]pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[2-[(cyclopropylamino)methyl]pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137007881 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-[2-[(cyclopropylamino)methyl]pyrrolidin-1-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CCCC2CNC2CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H20N4O/c1-9-15-12(7-13(18)16-9)17-6-2-3-11(17)8-14-10-4-5-10/h7,10-11,14H,2-6,8H2,1H3,(H,15,16,18) |
| InChIKey | MVCHNZQCLNOZNF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |