C7H5ClN6OS — CID 137008297
1-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 137008297) has the molecular formula C7H5ClN6OS and a molecular weight of 256.68 g/mol. Its IUPAC name is 1-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 137008297 |
| Molecular Formula | C7H5ClN6OS |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 1-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(-c2nc[nH]c(=O)c2Cl)n1 |
| InChI | InChI=1S/C7H5ClN6OS/c8-3-6(10-1-11-7(3)15)14-2-12-5(13-14)4(9)16/h1-2H,(H2,9,16)(H,10,11,15) |
| InChIKey | JKMDVCQGCLJKKW-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|