C11H16ClN3O2 — CID 137009227
5-chloro-4-(4-ethoxypiperidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 137009227) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-chloro-4-(4-ethoxypiperidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(4-ethoxypiperidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137009227 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 5-chloro-4-(4-ethoxypiperidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | CCOC1CCN(c2nc[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C11H16ClN3O2/c1-2-17-8-3-5-15(6-4-8)10-9(12)11(16)14-7-13-10/h7-8H,2-6H2,1H3,(H,13,14,16) |
| InChIKey | QOUPTYLVFWJIFS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |