C12H16N4O2 — CID 137009553
1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-5-one (PubChem CID 137009553) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 137009553 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(c2cc(=O)[nH]c(C3CC3)n2)CCN1 |
| InChI | InChI=1S/C12H16N4O2/c17-10-3-5-16(6-4-13-10)9-7-11(18)15-12(14-9)8-1-2-8/h7-8H,1-6H2,(H,13,17)(H,14,15,18) |
| InChIKey | JQAWZJHAXLXYNY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |