C14H20N4O2 — CID 137009888
6-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 137009888) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 137009888 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | CCc1nc(N2CCC3NC(=O)CCC3C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H20N4O2/c1-2-11-16-12(7-14(20)17-11)18-6-5-10-9(8-18)3-4-13(19)15-10/h7,9-10H,2-6,8H2,1H3,(H,15,19)(H,16,17,20) |
| InChIKey | AHJSBAOLMGODDG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |