C27H29N3O3 — CID 137010113
(6'aS,7'S,10'aS)-2'-anilino-7'-methyl-10'a-phenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one (PubChem CID 137010113) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (6'aS,7'S,10'aS)-2'-anilino-7'-methyl-10'a-phenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one.
| Compound Name | (6'aS,7'S,10'aS)-2'-anilino-7'-methyl-10'a-phenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
|---|---|
| PubChem CID | 137010113 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (6'aS,7'S,10'aS)-2'-anilino-7'-methyl-10'a-phenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
| SMILES | C[C@H]1[C@@H]2CCc3c(nc(Nc4ccccc4)[nH]c3=O)[C@@]2(c2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C27H29N3O3/c1-18-22-13-12-21-23(29-25(30-24(21)31)28-20-10-6-3-7-11-20)26(22,19-8-4-2-5-9-19)14-15-27(18)32-16-17-33-27/h2-11,18,22H,12-17H2,1H3,(H2,28,29,30,31)/t18-,22-,26+/m0/s1 |
| InChIKey | UVMJBLQXPVPNCQ-HBTLOVQCSA-N |
| XLogP | 4.53 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |