C21H21F3N4O2 — CID 137010317
(5R,7S)-5-(3,4-dimethoxyphenyl)-2-(2-methyl-4-pyridinyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 137010317) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is (5R,7S)-5-(3,4-dimethoxyphenyl)-2-(2-methyl-4-pyridinyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-5-(3,4-dimethoxyphenyl)-2-(2-methyl-4-pyridinyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 137010317 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (5R,7S)-5-(3,4-dimethoxyphenyl)-2-(2-methyl-4-pyridinyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(-c4ccnc(C)c4)cc3N2)cc1OC |
| InChI | InChI=1S/C21H21F3N4O2/c1-12-8-14(6-7-25-12)16-11-20-26-15(10-19(21(22,23)24)28(20)27-16)13-4-5-17(29-2)18(9-13)30-3/h4-9,11,15,19,26H,10H2,1-3H3/t15-,19+/m1/s1 |
| InChIKey | FQXOLHUOSIASBL-BEFAXECRSA-N |
| XLogP | 4.93 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |