C29H25F6N7O3 — CID 137010349
N-diazenyl-5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(ethoxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 137010349) has the molecular formula C29H25F6N7O3 and a molecular weight of 633.55 g/mol. Its IUPAC name is N-diazenyl-5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(ethoxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-diazenyl-5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(ethoxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 137010349 |
| Molecular Formula | C29H25F6N7O3 |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | N-diazenyl-5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[4-(ethoxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | [H]/N=N/NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2cc(COCC)c(C(F)(F)F)n2)ccc1F |
| InChI | InChI=1S/C29H25F6N7O3/c1-2-45-15-18-13-42(40-27(18)29(33,34)35)14-25(43)38-24(10-16-8-19(30)12-20(31)9-16)26-21(4-3-7-37-26)17-5-6-23(32)22(11-17)28(44)39-41-36/h3-9,11-13,24H,2,10,14-15H2,1H3,(H,38,43)(H2,36,39,44)/t24-/m0/s1 |
| InChIKey | IKDVUBLIOWTVMN-DEOSSOPVSA-N |
| XLogP | 5.69 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|