About N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine
N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine (PubChem CID 137010918) has the molecular formula C12H20N4OS
and a molecular weight of 268.39 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine |
| PubChem CID | 137010918 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine |
| SMILES | COCCC1CS/C(=N\Cc2cn(C)nc2C)N1 |
| InChI | InChI=1S/C12H20N4OS/c1-9-10(7-16(2)15-9)6-13-12-14-11(8-18-12)4-5-17-3/h7,11H,4-6,8H2,1-3H3,(H,13,14) |
| InChIKey | OKZLHXMZTRWABL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine?
The IUPAC name of N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine (CID 137010918) is N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine.
What is the SMILES notation for N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine?
The canonical SMILES for N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine is COCCC1CS/C(=N\Cc2cn(C)nc2C)N1.
What is the InChIKey of N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine?
The InChIKey is OKZLHXMZTRWABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4OS/c1-9-10(7-16(2)15-9)6-13-12-14-11(8-18-12)4-5-17-3/h7,11H,4-6,8H2,1-3H3,(H,13,14).
What are the key properties of N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine?
N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine has a molecular weight of 268.39 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyethyl)-1,3-thiazolidin-2-imine is sourced from PubChem (CID 137010918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).