C13H18F2N2O — CID 137010982
2-(3,3-difluorocyclohexyl)-4-ethyl-5-methyl-1H-pyrimidin-6-one (PubChem CID 137010982) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-4-ethyl-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3,3-difluorocyclohexyl)-4-ethyl-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137010982 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-4-ethyl-5-methyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(C2CCCC(F)(F)C2)[nH]c(=O)c1C |
| InChI | InChI=1S/C13H18F2N2O/c1-3-10-8(2)12(18)17-11(16-10)9-5-4-6-13(14,15)7-9/h9H,3-7H2,1-2H3,(H,16,17,18) |
| InChIKey | VQAZVWJNEZCMES-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |