C15H19N3O3 — CID 137011204
4-[5-(4-aminooxan-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenol (PubChem CID 137011204) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[5-(4-aminooxan-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenol.
| Compound Name | 4-[5-(4-aminooxan-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 137011204 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[5-(4-aminooxan-4-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2noc(C3(N)CCOCC3)n2)cc(C)c1O |
| InChI | InChI=1S/C15H19N3O3/c1-9-7-11(8-10(2)12(9)19)13-17-14(21-18-13)15(16)3-5-20-6-4-15/h7-8,19H,3-6,16H2,1-2H3 |
| InChIKey | CZNLHDYNKDONFX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |