C15H10ClFN2O2 — CID 137011336
2-[3-[(3-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-4-fluorophenol (PubChem CID 137011336) has the molecular formula C15H10ClFN2O2 and a molecular weight of 304.71 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-4-fluorophenol.
| Compound Name | 2-[3-[(3-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-4-fluorophenol |
|---|---|
| PubChem CID | 137011336 |
| Molecular Formula | C15H10ClFN2O2 |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-4-fluorophenol |
| SMILES | Oc1ccc(F)cc1-c1nc(Cc2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C15H10ClFN2O2/c16-10-3-1-2-9(6-10)7-14-18-15(21-19-14)12-8-11(17)4-5-13(12)20/h1-6,8,20H,7H2 |
| InChIKey | OMHRHQZGNGKFAM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |