C13H12N4S — CID 137012222
6-thiophen-3-yl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene (PubChem CID 137012222) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 6-thiophen-3-yl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene.
| Compound Name | 6-thiophen-3-yl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
|---|---|
| PubChem CID | 137012222 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-thiophen-3-yl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
| SMILES | c1cnc2nn3c(c2c1)NCCC3c1ccsc1 |
| InChI | InChI=1S/C13H12N4S/c1-2-10-12(14-5-1)16-17-11(3-6-15-13(10)17)9-4-7-18-8-9/h1-2,4-5,7-8,11,15H,3,6H2 |
| InChIKey | OIDOFFVWTNZPFV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |