C13H17N5 — CID 137012230
14-methyl-1,5,9,15,17-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-10,12,14,16-tetraene (PubChem CID 137012230) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 14-methyl-1,5,9,15,17-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-10,12,14,16-tetraene.
| Compound Name | 14-methyl-1,5,9,15,17-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-10,12,14,16-tetraene |
|---|---|
| PubChem CID | 137012230 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 14-methyl-1,5,9,15,17-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-10,12,14,16-tetraene |
| SMILES | Cc1ccc2c3n(nc2n1)C1CCNCC1CN3 |
| InChI | InChI=1S/C13H17N5/c1-8-2-3-10-12(16-8)17-18-11-4-5-14-6-9(11)7-15-13(10)18/h2-3,9,11,14-15H,4-7H2,1H3 |
| InChIKey | PLRRYTDNWSCLRP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |