C11H14F2N2O4 — CID 137012994
2-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 137012994) has the molecular formula C11H14F2N2O4 and a molecular weight of 276.24 g/mol. Its IUPAC name is 2-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 137012994 |
| Molecular Formula | C11H14F2N2O4 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(CCOCC(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C11H14F2N2O4/c1-6-7(4-10(16)17)11(18)15-9(14-6)2-3-19-5-8(12)13/h8H,2-5H2,1H3,(H,16,17)(H,14,15,18) |
| InChIKey | NTVAREBQPTYGJA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|