C23H30N4O2S — CID 137013260
4-(1,3-benzothiazol-2-yl)-2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methoxyphenol (PubChem CID 137013260) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methoxyphenol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 137013260 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methoxyphenol |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(CN2CCN(C)CCN(C)CC2)c1O |
| InChI | InChI=1S/C23H30N4O2S/c1-25-8-9-26(2)11-13-27(12-10-25)16-18-14-17(15-20(29-3)22(18)28)23-24-19-6-4-5-7-21(19)30-23/h4-7,14-15,28H,8-13,16H2,1-3H3 |
| InChIKey | PHKVONKGRLVEIH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|