C29H27N5O2S — CID 137013263
4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol (PubChem CID 137013263) has the molecular formula C29H27N5O2S and a molecular weight of 509.64 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 137013263 |
| Molecular Formula | C29H27N5O2S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(CN2Cc3cccc(n3)CNCc3cccc(n3)C2)c1O |
| InChI | InChI=1S/C29H27N5O2S/c1-36-26-13-19(29-33-25-10-2-3-11-27(25)37-29)12-20(28(26)35)16-34-17-23-8-4-6-21(31-23)14-30-15-22-7-5-9-24(18-34)32-22/h2-13,30,35H,14-18H2,1H3 |
| InChIKey | KHXYYBQVWXRQAY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|