About N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine
N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine (PubChem CID 137013296) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine |
| PubChem CID | 137013296 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine |
| SMILES | CNc1csc(-c2cc[nH]c2)n1 |
| InChI | InChI=1S/C8H9N3S/c1-9-7-5-12-8(11-7)6-2-3-10-4-6/h2-5,9-10H,1H3 |
| InChIKey | MVLUDFZZINKSRY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine?
The IUPAC name of N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine (CID 137013296) is N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine.
What is the SMILES notation for N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine?
The canonical SMILES for N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine is CNc1csc(-c2cc[nH]c2)n1.
What is the InChIKey of N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine?
The InChIKey is MVLUDFZZINKSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-9-7-5-12-8(11-7)6-2-3-10-4-6/h2-5,9-10H,1H3.
What are the key properties of N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine?
N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine has a molecular weight of 179.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(1H-pyrrol-3-yl)-1,3-thiazol-4-amine is sourced from PubChem (CID 137013296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).