C26H25FN5O9P — CID 137014054
2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 137014054) has the molecular formula C26H25FN5O9P and a molecular weight of 601.48 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014054 |
| Molecular Formula | C26H25FN5O9P |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1ccc(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2oc(=O)oc2-c2ccccc2)cc1F |
| InChI | InChI=1S/C26H25FN5O9P/c1-36-19-8-7-16(11-18(19)27)12-38-42(35,39-13-20-22(41-26(34)40-20)17-5-3-2-4-6-17)15-37-10-9-32-14-29-21-23(32)30-25(28)31-24(21)33/h2-8,11,14H,9-10,12-13,15H2,1H3,(H3,28,30,31,33) |
| InChIKey | GXVCKTRQKWBJEQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 186.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|