C26H29FN5O11P — CID 137014081
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxymethyl (3,4-dimethoxyphenyl) carbonate (PubChem CID 137014081) has the molecular formula C26H29FN5O11P and a molecular weight of 637.51 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxymethyl (3,4-dimethoxyphenyl) carbonate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxymethyl (3,4-dimethoxyphenyl) carbonate |
|---|---|
| PubChem CID | 137014081 |
| Molecular Formula | C26H29FN5O11P |
| Molecular Weight | 637.51 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxymethyl (3,4-dimethoxyphenyl) carbonate |
| SMILES | COc1ccc(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCOC(=O)Oc2ccc(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C26H29FN5O11P/c1-36-19-6-4-16(10-18(19)27)12-41-44(35,15-39-9-8-32-13-29-22-23(32)30-25(28)31-24(22)33)42-14-40-26(34)43-17-5-7-20(37-2)21(11-17)38-3/h4-7,10-11,13H,8-9,12,14-15H2,1-3H3,(H3,28,30,31,33) |
| InChIKey | IPQJZIFPVOLRMW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 197.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|