C22H19IN4O2 — CID 137014293
2-[4-[N-(2-iodoethyl)-4-methylanilino]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137014293) has the molecular formula C22H19IN4O2 and a molecular weight of 498.32 g/mol. Its IUPAC name is 2-[4-[N-(2-iodoethyl)-4-methylanilino]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-[N-(2-iodoethyl)-4-methylanilino]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137014293 |
| Molecular Formula | C22H19IN4O2 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 2-[4-[N-(2-iodoethyl)-4-methylanilino]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc(N(CCI)c2ccc(Oc3nc4cnccc4c(=O)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C22H19IN4O2/c1-15-2-4-16(5-3-15)27(13-11-23)17-6-8-18(9-7-17)29-22-25-20-14-24-12-10-19(20)21(28)26-22/h2-10,12,14H,11,13H2,1H3,(H,25,26,28) |
| InChIKey | MATZLOVUXGWYST-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|