C19H19F2N5O — CID 137014423
(9S,11R)-3,11-difluoro-7-oxa-13,16,20,21,24-pentazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene (PubChem CID 137014423) has the molecular formula C19H19F2N5O and a molecular weight of 371.39 g/mol. Its IUPAC name is (9S,11R)-3,11-difluoro-7-oxa-13,16,20,21,24-pentazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene.
| Compound Name | (9S,11R)-3,11-difluoro-7-oxa-13,16,20,21,24-pentazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene |
|---|---|
| PubChem CID | 137014423 |
| Molecular Formula | C19H19F2N5O |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (9S,11R)-3,11-difluoro-7-oxa-13,16,20,21,24-pentazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene |
| SMILES | Fc1ccc2cc1-c1cnn3ccc(nc13)NCCN1C[C@H](F)C[C@H]1CO2 |
| InChI | InChI=1S/C19H19F2N5O/c20-12-7-13-11-27-14-1-2-17(21)15(8-14)16-9-23-26-5-3-18(24-19(16)26)22-4-6-25(13)10-12/h1-3,5,8-9,12-13H,4,6-7,10-11H2,(H,22,24)/t12-,13+/m1/s1 |
| InChIKey | CNFANJDDSZWZPI-OLZOCXBDSA-N |
| XLogP | 2.75 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |