C26H24ClFN5O9P — CID 137014481
2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 137014481) has the molecular formula C26H24ClFN5O9P and a molecular weight of 635.93 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014481 |
| Molecular Formula | C26H24ClFN5O9P |
| Molecular Weight | 635.93 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3-fluoro-4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1ccc(-c2oc(=O)oc2COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(Cl)c2)cc1F |
| InChI | InChI=1S/C26H24ClFN5O9P/c1-37-19-6-5-16(10-18(19)28)22-20(41-26(35)42-22)12-40-43(36,39-11-15-3-2-4-17(27)9-15)14-38-8-7-33-13-30-21-23(33)31-25(29)32-24(21)34/h2-6,9-10,13H,7-8,11-12,14H2,1H3,(H3,29,31,32,34) |
| InChIKey | YHCAZISKDCTYPH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 186.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|