C9H6N4 — CID 137014851
5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaene (PubChem CID 137014851) has the molecular formula C9H6N4 and a molecular weight of 170.18 g/mol. Its IUPAC name is 5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 137014851 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaene |
| SMILES | c1cc2c(n1)ncc1cnc[nH]c12 |
| InChI | InChI=1S/C9H6N4/c1-2-11-9-7(1)8-6(4-12-9)3-10-5-13-8/h1-5H,(H,10,13) |
| InChIKey | OTRLQODQTCDWPX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |