About 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol
4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol (PubChem CID 137015300) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol |
| PubChem CID | 137015300 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol |
| SMILES | Nc1cc(-c2ccc(O)cc2O)on1 |
| InChI | InChI=1S/C9H8N2O3/c10-9-4-8(14-11-9)6-2-1-5(12)3-7(6)13/h1-4,12-13H,(H2,10,11) |
| InChIKey | XZDOIJPNCPJCGL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol?
The IUPAC name of 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol (CID 137015300) is 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol?
The canonical SMILES for 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol is Nc1cc(-c2ccc(O)cc2O)on1.
What is the InChIKey of 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol?
The InChIKey is XZDOIJPNCPJCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c10-9-4-8(14-11-9)6-2-1-5(12)3-7(6)13/h1-4,12-13H,(H2,10,11).
What are the key properties of 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol?
4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol has a molecular weight of 192.17 g/mol, XLogP of 1.34, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-1,2-oxazol-5-yl)benzene-1,3-diol is sourced from PubChem (CID 137015300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).