C11H16BrN3O3 — CID 137015458
methyl 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-4-methylpentanoate (PubChem CID 137015458) has the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is methyl 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 137015458 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | methyl 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H16BrN3O3/c1-6(2)4-7(11(17)18-3)15-9-8(12)10(16)14-5-13-9/h5-7H,4H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | OTIPLZPQEZLXBR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |