C10H14F3N3O — CID 137015545
2-methyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one (PubChem CID 137015545) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-methyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137015545 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-methyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCCCCC(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H14F3N3O/c1-7-15-8(6-9(17)16-7)14-5-3-2-4-10(11,12)13/h6H,2-5H2,1H3,(H2,14,15,16,17) |
| InChIKey | NDEDEDUXACMYKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|