C13H20N4O — CID 137015685
4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methyl-1H-pyrimidin-6-one (PubChem CID 137015685) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137015685 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CCN3CCCCC3C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H20N4O/c1-10-14-12(8-13(18)15-10)17-7-6-16-5-3-2-4-11(16)9-17/h8,11H,2-7,9H2,1H3,(H,14,15,18) |
| InChIKey | RFNOHEIEANPINN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |