C10H14N4O4 — CID 137015863
4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]oxolane-3-carboxylic acid (PubChem CID 137015863) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 137015863 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 4-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(c1nc[nH]c(=O)c1N)C1COCC1C(=O)O |
| InChI | InChI=1S/C10H14N4O4/c1-14(6-3-18-2-5(6)10(16)17)8-7(11)9(15)13-4-12-8/h4-6H,2-3,11H2,1H3,(H,16,17)(H,12,13,15) |
| InChIKey | OIECRZAAUHPCAV-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |