About 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one
5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one (PubChem CID 137016046) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one |
| PubChem CID | 137016046 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one |
| SMILES | Nc1c(N2CCCC3(C2)OCCO3)nc[nH]c1=O |
| InChI | InChI=1S/C11H16N4O3/c12-8-9(13-7-14-10(8)16)15-3-1-2-11(6-15)17-4-5-18-11/h7H,1-6,12H2,(H,13,14,16) |
| InChIKey | KRKURUXXZKEFFH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one (CID 137016046) is 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one is Nc1c(N2CCCC3(C2)OCCO3)nc[nH]c1=O.
What is the InChIKey of 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one?
The InChIKey is KRKURUXXZKEFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c12-8-9(13-7-14-10(8)16)15-3-1-2-11(6-15)17-4-5-18-11/h7H,1-6,12H2,(H,13,14,16).
What are the key properties of 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one?
5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one has a molecular weight of 252.27 g/mol, XLogP of -0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 137016046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).