C12H19N3O3 — CID 137016441
4-(2-cyclopentyloxyethylamino)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 137016441) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(2-cyclopentyloxyethylamino)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(2-cyclopentyloxyethylamino)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016441 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-(2-cyclopentyloxyethylamino)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NCCOC2CCCC2)nc[nH]c1=O |
| InChI | InChI=1S/C12H19N3O3/c1-17-10-11(14-8-15-12(10)16)13-6-7-18-9-4-2-3-5-9/h8-9H,2-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | OYVGXVMFOUZNNU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|