C11H16F3N3O — CID 137016591
2-propan-2-yl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one (PubChem CID 137016591) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-propan-2-yl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-propan-2-yl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016591 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-propan-2-yl-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NCCCC(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H16F3N3O/c1-7(2)10-16-8(6-9(18)17-10)15-5-3-4-11(12,13)14/h6-7H,3-5H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | CRHBEXRXJXEWNU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|