C19H25N3O3 — CID 137016729
2-tert-butyl-N-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 137016729) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-tert-butyl-N-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137016729 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-tert-butyl-N-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2c(C)nc(C(C)(C)C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-12-15(17(24)22-18(21-12)19(2,3)4)16(23)20-11-10-13-6-8-14(25-5)9-7-13/h6-9H,10-11H2,1-5H3,(H,20,23)(H,21,22,24) |
| InChIKey | FKSVRAULIZLOIC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |