About 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol
6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol (PubChem CID 137017185) has the molecular formula C10H7FN2O4
and a molecular weight of 238.17 g/mol. Its IUPAC name is 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol |
| PubChem CID | 137017185 |
| Molecular Formula | C10H7FN2O4 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol |
| SMILES | Nc1cc(-c2cc3c(c(F)c2O)OCO3)on1 |
| InChI | InChI=1S/C10H7FN2O4/c11-8-9(14)4(5-2-7(12)13-17-5)1-6-10(8)16-3-15-6/h1-2,14H,3H2,(H2,12,13) |
| InChIKey | CVFHBLJDUBWIHW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol?
The IUPAC name of 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol (CID 137017185) is 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol is Nc1cc(-c2cc3c(c(F)c2O)OCO3)on1.
What is the InChIKey of 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol?
The InChIKey is CVFHBLJDUBWIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O4/c11-8-9(14)4(5-2-7(12)13-17-5)1-6-10(8)16-3-15-6/h1-2,14H,3H2,(H2,12,13).
What are the key properties of 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol?
6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol has a molecular weight of 238.17 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-amino-1,2-oxazol-5-yl)-4-fluoro-1,3-benzodioxol-5-ol is sourced from PubChem (CID 137017185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).