C22H23FN6O3S — CID 137017597
8-[[4-[(3R,6S)-5-amino-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-fluoro-2-pyridinyl]amino]-1,7-naphthyridin-3-ol (PubChem CID 137017597) has the molecular formula C22H23FN6O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is 8-[[4-[(3R,6S)-5-amino-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-fluoro-2-pyridinyl]amino]-1,7-naphthyridin-3-ol.
| Compound Name | 8-[[4-[(3R,6S)-5-amino-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-fluoro-2-pyridinyl]amino]-1,7-naphthyridin-3-ol |
|---|---|
| PubChem CID | 137017597 |
| Molecular Formula | C22H23FN6O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 8-[[4-[(3R,6S)-5-amino-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-fluoro-2-pyridinyl]amino]-1,7-naphthyridin-3-ol |
| SMILES | C[C@@]1(c2cc(Nc3nccc4cc(O)cnc34)ncc2F)CS(=O)(=O)[C@@](C)(C2CC2)C(N)=N1 |
| InChI | InChI=1S/C22H23FN6O3S/c1-21(11-33(31,32)22(2,13-3-4-13)20(24)29-21)15-8-17(26-10-16(15)23)28-19-18-12(5-6-25-19)7-14(30)9-27-18/h5-10,13,30H,3-4,11H2,1-2H3,(H2,24,29)(H,25,26,28)/t21-,22-/m0/s1 |
| InChIKey | KUEIENKSQXRQDS-VXKWHMMOSA-N |
| XLogP | 2.78 |
| TPSA | 143.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |