C14H17ClN2O3 — CID 137017728
5-chloro-2-[3-(3-methoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 137017728) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 5-chloro-2-[3-(3-methoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 5-chloro-2-[3-(3-methoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 137017728 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-chloro-2-[3-(3-methoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CCC(CC)(OC)c1noc(-c2ccc(Cl)cc2O)n1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-4-14(5-2,19-3)13-16-12(20-17-13)10-7-6-9(15)8-11(10)18/h6-8,18H,4-5H2,1-3H3 |
| InChIKey | ZNNHFUDIGZFJNY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |