C15H17ClN2O3 — CID 137017762
2-chloro-4-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 137017762) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is 2-chloro-4-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-chloro-4-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 137017762 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-chloro-4-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | COC1(c2noc(-c3ccc(O)c(Cl)c3)n2)CCCCC1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-20-15(7-3-2-4-8-15)14-17-13(21-18-14)10-5-6-12(19)11(16)9-10/h5-6,9,19H,2-4,7-8H2,1H3 |
| InChIKey | FKXLKXWNVLLNNE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |