C12H19N5S — CID 137018153
6-ethylimino-N,2-dimethyl-N-(5-methylthiophen-3-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 137018153) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 6-ethylimino-N,2-dimethyl-N-(5-methylthiophen-3-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-ethylimino-N,2-dimethyl-N-(5-methylthiophen-3-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 137018153 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 6-ethylimino-N,2-dimethyl-N-(5-methylthiophen-3-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC/N=C1/NC(N(C)c2csc(C)c2)=NC(C)N1 |
| InChI | InChI=1S/C12H19N5S/c1-5-13-11-14-9(3)15-12(16-11)17(4)10-6-8(2)18-7-10/h6-7,9H,5H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | PSFFWQSRKJANMA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|