C22H30N6O5 — CID 137018241
tert-butyl 4-[3-[(E)-N'-hydroxy-N-(3-methylbut-2-enoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate (PubChem CID 137018241) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-N'-hydroxy-N-(3-methylbut-2-enoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(E)-N'-hydroxy-N-(3-methylbut-2-enoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137018241 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | tert-butyl 4-[3-[(E)-N'-hydroxy-N-(3-methylbut-2-enoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate |
| SMILES | CC(C)=CC(=O)N/C(=N/O)c1cnn2c(C3CCN(C(=O)OC(C)(C)C)CC3)cc(=O)[nH]c12 |
| InChI | InChI=1S/C22H30N6O5/c1-13(2)10-17(29)24-19(26-32)15-12-23-28-16(11-18(30)25-20(15)28)14-6-8-27(9-7-14)21(31)33-22(3,4)5/h10-12,14,32H,6-9H2,1-5H3,(H,25,30)(H,24,26,29) |
| InChIKey | NMAUMRYZNLDFKN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|