C15H16N4OS — CID 137018249
7-piperidin-4-yl-3-thiophen-2-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 137018249) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 7-piperidin-4-yl-3-thiophen-2-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-piperidin-4-yl-3-thiophen-2-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137018249 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 7-piperidin-4-yl-3-thiophen-2-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=c1cc(C2CCNCC2)n2ncc(-c3cccs3)c2[nH]1 |
| InChI | InChI=1S/C15H16N4OS/c20-14-8-12(10-3-5-16-6-4-10)19-15(18-14)11(9-17-19)13-2-1-7-21-13/h1-2,7-10,16H,3-6H2,(H,18,20) |
| InChIKey | OXNMSHURNHMOGT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |