C15H19FN4O3 — CID 137018395
3-fluoropropyl 5-oxo-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 137018395) has the molecular formula C15H19FN4O3 and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-fluoropropyl 5-oxo-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | 3-fluoropropyl 5-oxo-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 137018395 |
| Molecular Formula | C15H19FN4O3 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-fluoropropyl 5-oxo-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | O=C(OCCCF)c1cnn2c(C3CCNCC3)cc(=O)[nH]c12 |
| InChI | InChI=1S/C15H19FN4O3/c16-4-1-7-23-15(22)11-9-18-20-12(8-13(21)19-14(11)20)10-2-5-17-6-3-10/h8-10,17H,1-7H2,(H,19,21) |
| InChIKey | YSJANLGWPVEXLP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|