C13H15NO3 — CID 137018770
5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 137018770) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 137018770 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | C=C(C)C1Cc2cc(/C(C)=N/O)c(O)cc2O1 |
| InChI | InChI=1S/C13H15NO3/c1-7(2)12-5-9-4-10(8(3)14-16)11(15)6-13(9)17-12/h4,6,12,15-16H,1,5H2,2-3H3/b14-8+ |
| InChIKey | JELWULLPEWXKPJ-RIYZIHGNSA-N |
| XLogP | 2.47 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|