C20H16F2N4O — CID 137019000
2-(2,6-difluorophenyl)-4-(4-ethylanilino)-6H-pyrrolo[3,4-d]pyrimidin-5-ol (PubChem CID 137019000) has the molecular formula C20H16F2N4O and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(4-ethylanilino)-6H-pyrrolo[3,4-d]pyrimidin-5-ol.
| Compound Name | 2-(2,6-difluorophenyl)-4-(4-ethylanilino)-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
|---|---|
| PubChem CID | 137019000 |
| Molecular Formula | C20H16F2N4O |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(4-ethylanilino)-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
| SMILES | CCc1ccc(Nc2nc(-c3c(F)cccc3F)nc3c[nH]c(O)c23)cc1 |
| InChI | InChI=1S/C20H16F2N4O/c1-2-11-6-8-12(9-7-11)24-19-17-15(10-23-20(17)27)25-18(26-19)16-13(21)4-3-5-14(16)22/h3-10,23,27H,2H2,1H3,(H,24,25,26) |
| InChIKey | BIQBGOFJISMWOJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |